C7H9ClN2OS — CID 137272431
5-chloro-2-ethylsulfanyl-4-methyl-1H-pyrimidin-6-one (PubChem CID 137272431) has the molecular formula C7H9ClN2OS and a molecular weight of 204.68 g/mol. Its IUPAC name is 5-chloro-2-ethylsulfanyl-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-2-ethylsulfanyl-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137272431 |
| Molecular Formula | C7H9ClN2OS |
| Molecular Weight | 204.68 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | 5-chloro-2-ethylsulfanyl-4-methyl-1H-pyrimidin-6-one |
| SMILES | CCSc1nc(C)c(Cl)c(=O)[nH]1 |
| InChI | InChI=1S/C7H9ClN2OS/c1-3-12-7-9-4(2)5(8)6(11)10-7/h3H2,1-2H3,(H,9,10,11) |
| InChIKey | SVYVGRPKVLZLKH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.68 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |