About 5-diazo-2,6-dioxopyrimidine-4-carboxylic acid
5-diazo-2,6-dioxopyrimidine-4-carboxylic acid (PubChem CID 137274246) has the molecular formula C5H2N4O4
and a molecular weight of 182.09 g/mol. Its IUPAC name is 5-diazo-2,6-dioxopyrimidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-diazo-2,6-dioxopyrimidine-4-carboxylic acid |
| PubChem CID | 137274246 |
| Molecular Formula | C5H2N4O4 |
| Molecular Weight | 182.09 g/mol |
| Exact Mass | 182.01 |
| IUPAC Name | 5-diazo-2,6-dioxopyrimidine-4-carboxylic acid |
| SMILES | [N-]=[N+]=C1C(=O)NC(=O)N=C1C(=O)O |
| InChI | InChI=1S/C5H2N4O4/c6-9-1-2(4(11)12)7-5(13)8-3(1)10/h(H,11,12)(H,8,10,13) |
| InChIKey | NPSNBDHMMLFJNG-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 132.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.09 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 5-diazo-2,6-dioxopyrimidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-diazo-2,6-dioxopyrimidine-4-carboxylic acid?
The IUPAC name of 5-diazo-2,6-dioxopyrimidine-4-carboxylic acid (CID 137274246) is 5-diazo-2,6-dioxopyrimidine-4-carboxylic acid.
What is the SMILES notation for 5-diazo-2,6-dioxopyrimidine-4-carboxylic acid?
The canonical SMILES for 5-diazo-2,6-dioxopyrimidine-4-carboxylic acid is [N-]=[N+]=C1C(=O)NC(=O)N=C1C(=O)O.
What is the InChIKey of 5-diazo-2,6-dioxopyrimidine-4-carboxylic acid?
The InChIKey is NPSNBDHMMLFJNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2N4O4/c6-9-1-2(4(11)12)7-5(13)8-3(1)10/h(H,11,12)(H,8,10,13).
What are the key properties of 5-diazo-2,6-dioxopyrimidine-4-carboxylic acid?
5-diazo-2,6-dioxopyrimidine-4-carboxylic acid has a molecular weight of 182.09 g/mol, XLogP of -1.57, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-diazo-2,6-dioxopyrimidine-4-carboxylic acid is sourced from PubChem (CID 137274246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).