C20H16F3N5O2 — CID 137274993
1-phenyl-6-[2-[3-(trifluoromethyl)phenoxy]ethylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 137274993) has the molecular formula C20H16F3N5O2 and a molecular weight of 415.38 g/mol. Its IUPAC name is 1-phenyl-6-[2-[3-(trifluoromethyl)phenoxy]ethylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 1-phenyl-6-[2-[3-(trifluoromethyl)phenoxy]ethylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137274993 |
| Molecular Formula | C20H16F3N5O2 |
| Molecular Weight | 415.38 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 1-phenyl-6-[2-[3-(trifluoromethyl)phenoxy]ethylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(NCCOc2cccc(C(F)(F)F)c2)nc2c1cnn2-c1ccccc1 |
| InChI | InChI=1S/C20H16F3N5O2/c21-20(22,23)13-5-4-8-15(11-13)30-10-9-24-19-26-17-16(18(29)27-19)12-25-28(17)14-6-2-1-3-7-14/h1-8,11-12H,9-10H2,(H2,24,26,27,29) |
| InChIKey | PCBDSCIDRITESM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|