C15H21N5O — CID 137275475
1-tert-butyl-6-(cyclohex-3-en-1-ylamino)-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 137275475) has the molecular formula C15H21N5O and a molecular weight of 287.37 g/mol. Its IUPAC name is 1-tert-butyl-6-(cyclohex-3-en-1-ylamino)-5H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 1-tert-butyl-6-(cyclohex-3-en-1-ylamino)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137275475 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 1-tert-butyl-6-(cyclohex-3-en-1-ylamino)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CC(C)(C)n1ncc2c(=O)[nH]c(NC3CC=CCC3)nc21 |
| InChI | InChI=1S/C15H21N5O/c1-15(2,3)20-12-11(9-16-20)13(21)19-14(18-12)17-10-7-5-4-6-8-10/h4-5,9-10H,6-8H2,1-3H3,(H2,17,18,19,21) |
| InChIKey | FXLIIYNVHSIUKV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|