C15H21N7O — CID 137275989
6-[4-(dimethylamino)-6-propan-2-yl-1,3,5-triazin-2-yl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 137275989) has the molecular formula C15H21N7O and a molecular weight of 315.38 g/mol. Its IUPAC name is 6-[4-(dimethylamino)-6-propan-2-yl-1,3,5-triazin-2-yl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[4-(dimethylamino)-6-propan-2-yl-1,3,5-triazin-2-yl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137275989 |
| Molecular Formula | C15H21N7O |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 6-[4-(dimethylamino)-6-propan-2-yl-1,3,5-triazin-2-yl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | CC(C)c1nc(N(C)C)nc(N2CCc3nc[nH]c(=O)c3C2)n1 |
| InChI | InChI=1S/C15H21N7O/c1-9(2)12-18-14(21(3)4)20-15(19-12)22-6-5-11-10(7-22)13(23)17-8-16-11/h8-9H,5-7H2,1-4H3,(H,16,17,23) |
| InChIKey | OKKWBJNNIFMGKO-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |