C19H18F6N4O2 — CID 137276418
1-[(1R)-2,2-dimethyl-1-[4-(trifluoromethyl)phenyl]propyl]-3-(2,2,2-trifluoroethyl)-7H-pyrazolo[5,4-d]pyrimidine-4,6-dione (PubChem CID 137276418) has the molecular formula C19H18F6N4O2 and a molecular weight of 448.37 g/mol. Its IUPAC name is 1-[(1R)-2,2-dimethyl-1-[4-(trifluoromethyl)phenyl]propyl]-3-(2,2,2-trifluoroethyl)-7H-pyrazolo[5,4-d]pyrimidine-4,6-dione.
| Compound Name | 1-[(1R)-2,2-dimethyl-1-[4-(trifluoromethyl)phenyl]propyl]-3-(2,2,2-trifluoroethyl)-7H-pyrazolo[5,4-d]pyrimidine-4,6-dione |
|---|---|
| PubChem CID | 137276418 |
| Molecular Formula | C19H18F6N4O2 |
| Molecular Weight | 448.37 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 1-[(1R)-2,2-dimethyl-1-[4-(trifluoromethyl)phenyl]propyl]-3-(2,2,2-trifluoroethyl)-7H-pyrazolo[5,4-d]pyrimidine-4,6-dione |
| SMILES | CC(C)(C)[C@H](c1ccc(C(F)(F)F)cc1)n1nc(CC(F)(F)F)c2c(=O)[nH]c(=O)[nH]c21 |
| InChI | InChI=1S/C19H18F6N4O2/c1-17(2,3)13(9-4-6-10(7-5-9)19(23,24)25)29-14-12(15(30)27-16(31)26-14)11(28-29)8-18(20,21)22/h4-7,13H,8H2,1-3H3,(H2,26,27,30,31)/t13-/m0/s1 |
| InChIKey | CYGCPVPMKAOOAY-ZDUSSCGKSA-N |
| XLogP | 4.17 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |