About 2-cyclooctyl-7-hydroxy-3,6-dimethyl-4H-pyrazolo[1,5-a]pyrimidin-5-one
2-cyclooctyl-7-hydroxy-3,6-dimethyl-4H-pyrazolo[1,5-a]pyrimidin-5-one (PubChem CID 137276644) has the molecular formula C16H23N3O2
and a molecular weight of 289.38 g/mol. Its IUPAC name is 2-cyclooctyl-7-hydroxy-3,6-dimethyl-4H-pyrazolo[1,5-a]pyrimidin-5-one.
Molecular Properties
| Compound Name | 2-cyclooctyl-7-hydroxy-3,6-dimethyl-4H-pyrazolo[1,5-a]pyrimidin-5-one |
| PubChem CID | 137276644 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 2-cyclooctyl-7-hydroxy-3,6-dimethyl-4H-pyrazolo[1,5-a]pyrimidin-5-one |
| SMILES | Cc1c(O)n2nc(C3CCCCCCC3)c(C)c2[nH]c1=O |
| InChI | InChI=1S/C16H23N3O2/c1-10-13(12-8-6-4-3-5-7-9-12)18-19-14(10)17-15(20)11(2)16(19)21/h12,21H,3-9H2,1-2H3,(H,17,20) |
| InChIKey | JYHXLZCKZCYQOG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyclooctyl-7-hydroxy-3,6-dimethyl-4H-pyrazolo[1,5-a]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclooctyl-7-hydroxy-3,6-dimethyl-4H-pyrazolo[1,5-a]pyrimidin-5-one?
The IUPAC name of 2-cyclooctyl-7-hydroxy-3,6-dimethyl-4H-pyrazolo[1,5-a]pyrimidin-5-one (CID 137276644) is 2-cyclooctyl-7-hydroxy-3,6-dimethyl-4H-pyrazolo[1,5-a]pyrimidin-5-one.
What is the SMILES notation for 2-cyclooctyl-7-hydroxy-3,6-dimethyl-4H-pyrazolo[1,5-a]pyrimidin-5-one?
The canonical SMILES for 2-cyclooctyl-7-hydroxy-3,6-dimethyl-4H-pyrazolo[1,5-a]pyrimidin-5-one is Cc1c(O)n2nc(C3CCCCCCC3)c(C)c2[nH]c1=O.
What is the InChIKey of 2-cyclooctyl-7-hydroxy-3,6-dimethyl-4H-pyrazolo[1,5-a]pyrimidin-5-one?
The InChIKey is JYHXLZCKZCYQOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O2/c1-10-13(12-8-6-4-3-5-7-9-12)18-19-14(10)17-15(20)11(2)16(19)21/h12,21H,3-9H2,1-2H3,(H,17,20).
What are the key properties of 2-cyclooctyl-7-hydroxy-3,6-dimethyl-4H-pyrazolo[1,5-a]pyrimidin-5-one?
2-cyclooctyl-7-hydroxy-3,6-dimethyl-4H-pyrazolo[1,5-a]pyrimidin-5-one has a molecular weight of 289.38 g/mol, XLogP of 3.17, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclooctyl-7-hydroxy-3,6-dimethyl-4H-pyrazolo[1,5-a]pyrimidin-5-one is sourced from PubChem (CID 137276644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).