About 6-amino-1-methyl-5H-triazolo[4,5-c]pyridin-4-one
6-amino-1-methyl-5H-triazolo[4,5-c]pyridin-4-one (PubChem CID 137276646) has the molecular formula C6H7N5O
and a molecular weight of 165.16 g/mol. Its IUPAC name is 6-amino-1-methyl-5H-triazolo[4,5-c]pyridin-4-one.
Molecular Properties
| Compound Name | 6-amino-1-methyl-5H-triazolo[4,5-c]pyridin-4-one |
| PubChem CID | 137276646 |
| Molecular Formula | C6H7N5O |
| Molecular Weight | 165.16 g/mol |
| Exact Mass | 165.07 |
| IUPAC Name | 6-amino-1-methyl-5H-triazolo[4,5-c]pyridin-4-one |
| SMILES | Cn1nnc2c(=O)[nH]c(N)cc21 |
| InChI | InChI=1S/C6H7N5O/c1-11-3-2-4(7)8-6(12)5(3)9-10-11/h2H,1H3,(H3,7,8,12) |
| InChIKey | BAVQDFFHPGHAMA-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.16 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-amino-1-methyl-5H-triazolo[4,5-c]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1-methyl-5H-triazolo[4,5-c]pyridin-4-one?
The IUPAC name of 6-amino-1-methyl-5H-triazolo[4,5-c]pyridin-4-one (CID 137276646) is 6-amino-1-methyl-5H-triazolo[4,5-c]pyridin-4-one.
What is the SMILES notation for 6-amino-1-methyl-5H-triazolo[4,5-c]pyridin-4-one?
The canonical SMILES for 6-amino-1-methyl-5H-triazolo[4,5-c]pyridin-4-one is Cn1nnc2c(=O)[nH]c(N)cc21.
What is the InChIKey of 6-amino-1-methyl-5H-triazolo[4,5-c]pyridin-4-one?
The InChIKey is BAVQDFFHPGHAMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N5O/c1-11-3-2-4(7)8-6(12)5(3)9-10-11/h2H,1H3,(H3,7,8,12).
What are the key properties of 6-amino-1-methyl-5H-triazolo[4,5-c]pyridin-4-one?
6-amino-1-methyl-5H-triazolo[4,5-c]pyridin-4-one has a molecular weight of 165.16 g/mol, XLogP of -0.76, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1-methyl-5H-triazolo[4,5-c]pyridin-4-one is sourced from PubChem (CID 137276646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).