About N-[5-(5,7-dichloro-1,3-benzoxazol-2-yl)-2-methylphenyl]thiophene-2-carboxamide
N-[5-(5,7-dichloro-1,3-benzoxazol-2-yl)-2-methylphenyl]thiophene-2-carboxamide (PubChem CID 1372767) has the molecular formula C19H12Cl2N2O2S
and a molecular weight of 403.29 g/mol. Its IUPAC name is N-[5-(5,7-dichloro-1,3-benzoxazol-2-yl)-2-methylphenyl]thiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-[5-(5,7-dichloro-1,3-benzoxazol-2-yl)-2-methylphenyl]thiophene-2-carboxamide |
| PubChem CID | 1372767 |
| Molecular Formula | C19H12Cl2N2O2S |
| Molecular Weight | 403.29 g/mol |
| Exact Mass | 402.00 |
| IUPAC Name | N-[5-(5,7-dichloro-1,3-benzoxazol-2-yl)-2-methylphenyl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(-c2nc3cc(Cl)cc(Cl)c3o2)cc1NC(=O)c1cccs1 |
| InChI | InChI=1S/C19H12Cl2N2O2S/c1-10-4-5-11(7-14(10)22-18(24)16-3-2-6-26-16)19-23-15-9-12(20)8-13(21)17(15)25-19/h2-9H,1H3,(H,22,24) |
| InChIKey | CYZGIVUJFKWNLX-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.29 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[5-(5,7-dichloro-1,3-benzoxazol-2-yl)-2-methylphenyl]thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(5,7-dichloro-1,3-benzoxazol-2-yl)-2-methylphenyl]thiophene-2-carboxamide?
The IUPAC name of N-[5-(5,7-dichloro-1,3-benzoxazol-2-yl)-2-methylphenyl]thiophene-2-carboxamide (CID 1372767) is N-[5-(5,7-dichloro-1,3-benzoxazol-2-yl)-2-methylphenyl]thiophene-2-carboxamide.
What is the SMILES notation for N-[5-(5,7-dichloro-1,3-benzoxazol-2-yl)-2-methylphenyl]thiophene-2-carboxamide?
The canonical SMILES for N-[5-(5,7-dichloro-1,3-benzoxazol-2-yl)-2-methylphenyl]thiophene-2-carboxamide is Cc1ccc(-c2nc3cc(Cl)cc(Cl)c3o2)cc1NC(=O)c1cccs1.
What is the InChIKey of N-[5-(5,7-dichloro-1,3-benzoxazol-2-yl)-2-methylphenyl]thiophene-2-carboxamide?
The InChIKey is CYZGIVUJFKWNLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12Cl2N2O2S/c1-10-4-5-11(7-14(10)22-18(24)16-3-2-6-26-16)19-23-15-9-12(20)8-13(21)17(15)25-19/h2-9H,1H3,(H,22,24).
What are the key properties of N-[5-(5,7-dichloro-1,3-benzoxazol-2-yl)-2-methylphenyl]thiophene-2-carboxamide?
N-[5-(5,7-dichloro-1,3-benzoxazol-2-yl)-2-methylphenyl]thiophene-2-carboxamide has a molecular weight of 403.29 g/mol, XLogP of 6.42, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(5,7-dichloro-1,3-benzoxazol-2-yl)-2-methylphenyl]thiophene-2-carboxamide is sourced from PubChem (CID 1372767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).