C12H18F3N5 — CID 137277066
5-(C-methyl-N-piperidin-4-ylcarbonimidoyl)-2-(2,2,2-trifluoroethyl)-1H-imidazol-4-amine (PubChem CID 137277066) has the molecular formula C12H18F3N5 and a molecular weight of 289.31 g/mol. Its IUPAC name is 5-(C-methyl-N-piperidin-4-ylcarbonimidoyl)-2-(2,2,2-trifluoroethyl)-1H-imidazol-4-amine.
| Compound Name | 5-(C-methyl-N-piperidin-4-ylcarbonimidoyl)-2-(2,2,2-trifluoroethyl)-1H-imidazol-4-amine |
|---|---|
| PubChem CID | 137277066 |
| Molecular Formula | C12H18F3N5 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 5-(C-methyl-N-piperidin-4-ylcarbonimidoyl)-2-(2,2,2-trifluoroethyl)-1H-imidazol-4-amine |
| SMILES | C/C(=N\C1CCNCC1)c1[nH]c(CC(F)(F)F)nc1N |
| InChI | InChI=1S/C12H18F3N5/c1-7(18-8-2-4-17-5-3-8)10-11(16)20-9(19-10)6-12(13,14)15/h8,17H,2-6,16H2,1H3,(H,19,20)/b18-7+ |
| InChIKey | TVFNDADTDQFTCR-CNHKJKLMSA-N |
| XLogP | 1.66 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|