About 2-ethylsulfanyl-7-propyl-6H-pyrimido[4,5-d]pyrimidin-5-one
2-ethylsulfanyl-7-propyl-6H-pyrimido[4,5-d]pyrimidin-5-one (PubChem CID 137277389) has the molecular formula C11H14N4OS
and a molecular weight of 250.33 g/mol. Its IUPAC name is 2-ethylsulfanyl-7-propyl-6H-pyrimido[4,5-d]pyrimidin-5-one.
Molecular Properties
| Compound Name | 2-ethylsulfanyl-7-propyl-6H-pyrimido[4,5-d]pyrimidin-5-one |
| PubChem CID | 137277389 |
| Molecular Formula | C11H14N4OS |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 2-ethylsulfanyl-7-propyl-6H-pyrimido[4,5-d]pyrimidin-5-one |
| SMILES | CCCc1nc2nc(SCC)ncc2c(=O)[nH]1 |
| InChI | InChI=1S/C11H14N4OS/c1-3-5-8-13-9-7(10(16)14-8)6-12-11(15-9)17-4-2/h6H,3-5H2,1-2H3,(H,12,13,14,15,16) |
| InChIKey | GBYAYBDOESXPJK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-ethylsulfanyl-7-propyl-6H-pyrimido[4,5-d]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfanyl-7-propyl-6H-pyrimido[4,5-d]pyrimidin-5-one?
The IUPAC name of 2-ethylsulfanyl-7-propyl-6H-pyrimido[4,5-d]pyrimidin-5-one (CID 137277389) is 2-ethylsulfanyl-7-propyl-6H-pyrimido[4,5-d]pyrimidin-5-one.
What is the SMILES notation for 2-ethylsulfanyl-7-propyl-6H-pyrimido[4,5-d]pyrimidin-5-one?
The canonical SMILES for 2-ethylsulfanyl-7-propyl-6H-pyrimido[4,5-d]pyrimidin-5-one is CCCc1nc2nc(SCC)ncc2c(=O)[nH]1.
What is the InChIKey of 2-ethylsulfanyl-7-propyl-6H-pyrimido[4,5-d]pyrimidin-5-one?
The InChIKey is GBYAYBDOESXPJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4OS/c1-3-5-8-13-9-7(10(16)14-8)6-12-11(15-9)17-4-2/h6H,3-5H2,1-2H3,(H,12,13,14,15,16).
What are the key properties of 2-ethylsulfanyl-7-propyl-6H-pyrimido[4,5-d]pyrimidin-5-one?
2-ethylsulfanyl-7-propyl-6H-pyrimido[4,5-d]pyrimidin-5-one has a molecular weight of 250.33 g/mol, XLogP of 1.78, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfanyl-7-propyl-6H-pyrimido[4,5-d]pyrimidin-5-one is sourced from PubChem (CID 137277389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).