About 2-ethoxy-5H-pyrazolo[4,3-c]pyridin-4-one
2-ethoxy-5H-pyrazolo[4,3-c]pyridin-4-one (PubChem CID 137277707) has the molecular formula C8H9N3O2
and a molecular weight of 179.18 g/mol. Its IUPAC name is 2-ethoxy-5H-pyrazolo[4,3-c]pyridin-4-one.
Molecular Properties
| Compound Name | 2-ethoxy-5H-pyrazolo[4,3-c]pyridin-4-one |
| PubChem CID | 137277707 |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 2-ethoxy-5H-pyrazolo[4,3-c]pyridin-4-one |
| SMILES | CCOn1cc2c(=O)[nH]ccc2n1 |
| InChI | InChI=1S/C8H9N3O2/c1-2-13-11-5-6-7(10-11)3-4-9-8(6)12/h3-5H,2H2,1H3,(H,9,12) |
| InChIKey | NBINLKSKKDLYGG-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethoxy-5H-pyrazolo[4,3-c]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-5H-pyrazolo[4,3-c]pyridin-4-one?
The IUPAC name of 2-ethoxy-5H-pyrazolo[4,3-c]pyridin-4-one (CID 137277707) is 2-ethoxy-5H-pyrazolo[4,3-c]pyridin-4-one.
What is the SMILES notation for 2-ethoxy-5H-pyrazolo[4,3-c]pyridin-4-one?
The canonical SMILES for 2-ethoxy-5H-pyrazolo[4,3-c]pyridin-4-one is CCOn1cc2c(=O)[nH]ccc2n1.
What is the InChIKey of 2-ethoxy-5H-pyrazolo[4,3-c]pyridin-4-one?
The InChIKey is NBINLKSKKDLYGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O2/c1-2-13-11-5-6-7(10-11)3-4-9-8(6)12/h3-5H,2H2,1H3,(H,9,12).
What are the key properties of 2-ethoxy-5H-pyrazolo[4,3-c]pyridin-4-one?
2-ethoxy-5H-pyrazolo[4,3-c]pyridin-4-one has a molecular weight of 179.18 g/mol, XLogP of 0.17, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-5H-pyrazolo[4,3-c]pyridin-4-one is sourced from PubChem (CID 137277707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).