C21H21F2N5O4S — CID 137277717
N-[3-[4-amino-1-methyl-5-(methyldiazenyl)-6-oxo-3-pyridinyl]-4-(2,4-difluorophenoxy)phenyl]ethanesulfonamide (PubChem CID 137277717) has the molecular formula C21H21F2N5O4S and a molecular weight of 477.49 g/mol. Its IUPAC name is N-[3-[4-amino-1-methyl-5-(methyldiazenyl)-6-oxo-3-pyridinyl]-4-(2,4-difluorophenoxy)phenyl]ethanesulfonamide.
| Compound Name | N-[3-[4-amino-1-methyl-5-(methyldiazenyl)-6-oxo-3-pyridinyl]-4-(2,4-difluorophenoxy)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 137277717 |
| Molecular Formula | C21H21F2N5O4S |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | N-[3-[4-amino-1-methyl-5-(methyldiazenyl)-6-oxo-3-pyridinyl]-4-(2,4-difluorophenoxy)phenyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc(Oc2ccc(F)cc2F)c(-c2cn(C)c(=O)c(/N=N/C)c2N)c1 |
| InChI | InChI=1S/C21H21F2N5O4S/c1-4-33(30,31)27-13-6-8-17(32-18-7-5-12(22)9-16(18)23)14(10-13)15-11-28(3)21(29)20(19(15)24)26-25-2/h5-11,27H,4,24H2,1-3H3/b26-25+ |
| InChIKey | AOHHITIVNKCKNA-OCEACIFDSA-N |
| XLogP | 4.18 |
| TPSA | 128.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|