About 3-[cyclopenta-1,4-dien-1-yl(phenyl)methyl]-4-methyl-1H-indole
3-[cyclopenta-1,4-dien-1-yl(phenyl)methyl]-4-methyl-1H-indole (PubChem CID 137278057) has the molecular formula C21H19N
and a molecular weight of 285.39 g/mol. Its IUPAC name is 3-[cyclopenta-1,4-dien-1-yl(phenyl)methyl]-4-methyl-1H-indole.
Molecular Properties
| Compound Name | 3-[cyclopenta-1,4-dien-1-yl(phenyl)methyl]-4-methyl-1H-indole |
| PubChem CID | 137278057 |
| Molecular Formula | C21H19N |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 3-[cyclopenta-1,4-dien-1-yl(phenyl)methyl]-4-methyl-1H-indole |
| SMILES | Cc1cccc2[nH]cc(C(C3=CCC=C3)c3ccccc3)c12 |
| InChI | InChI=1S/C21H19N/c1-15-8-7-13-19-20(15)18(14-22-19)21(17-11-5-6-12-17)16-9-3-2-4-10-16/h2-5,7-14,21-22H,6H2,1H3 |
| InChIKey | TVQZQHORVPVUCZ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-[cyclopenta-1,4-dien-1-yl(phenyl)methyl]-4-methyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[cyclopenta-1,4-dien-1-yl(phenyl)methyl]-4-methyl-1H-indole?
The IUPAC name of 3-[cyclopenta-1,4-dien-1-yl(phenyl)methyl]-4-methyl-1H-indole (CID 137278057) is 3-[cyclopenta-1,4-dien-1-yl(phenyl)methyl]-4-methyl-1H-indole.
What is the SMILES notation for 3-[cyclopenta-1,4-dien-1-yl(phenyl)methyl]-4-methyl-1H-indole?
The canonical SMILES for 3-[cyclopenta-1,4-dien-1-yl(phenyl)methyl]-4-methyl-1H-indole is Cc1cccc2[nH]cc(C(C3=CCC=C3)c3ccccc3)c12.
What is the InChIKey of 3-[cyclopenta-1,4-dien-1-yl(phenyl)methyl]-4-methyl-1H-indole?
The InChIKey is TVQZQHORVPVUCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N/c1-15-8-7-13-19-20(15)18(14-22-19)21(17-11-5-6-12-17)16-9-3-2-4-10-16/h2-5,7-14,21-22H,6H2,1H3.
What are the key properties of 3-[cyclopenta-1,4-dien-1-yl(phenyl)methyl]-4-methyl-1H-indole?
3-[cyclopenta-1,4-dien-1-yl(phenyl)methyl]-4-methyl-1H-indole has a molecular weight of 285.39 g/mol, XLogP of 5.49, 3 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[cyclopenta-1,4-dien-1-yl(phenyl)methyl]-4-methyl-1H-indole is sourced from PubChem (CID 137278057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).