C16H11BF3N3 — CID 137278580
5-[4-(trifluoromethyl)phenyl]-6H-pyrazolo[1,5-c][1,3,2]benzodiazaborinine (PubChem CID 137278580) has the molecular formula C16H11BF3N3 and a molecular weight of 313.09 g/mol. Its IUPAC name is 5-[4-(trifluoromethyl)phenyl]-6H-pyrazolo[1,5-c][1,3,2]benzodiazaborinine.
| Compound Name | 5-[4-(trifluoromethyl)phenyl]-6H-pyrazolo[1,5-c][1,3,2]benzodiazaborinine |
|---|---|
| PubChem CID | 137278580 |
| Molecular Formula | C16H11BF3N3 |
| Molecular Weight | 313.09 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 5-[4-(trifluoromethyl)phenyl]-6H-pyrazolo[1,5-c][1,3,2]benzodiazaborinine |
| SMILES | FC(F)(F)c1ccc(B2Nc3ccccc3-c3ccnn32)cc1 |
| InChI | InChI=1S/C16H11BF3N3/c18-16(19,20)11-5-7-12(8-6-11)17-22-14-4-2-1-3-13(14)15-9-10-21-23(15)17/h1-10,22H |
| InChIKey | CLBRPZULULROLT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.09 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|