About 5-(4-chlorophenyl)-6H-pyrazolo[1,5-c][1,3,2]benzodiazaborinine
5-(4-chlorophenyl)-6H-pyrazolo[1,5-c][1,3,2]benzodiazaborinine (PubChem CID 137278587) has the molecular formula C15H11BClN3
and a molecular weight of 279.54 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-6H-pyrazolo[1,5-c][1,3,2]benzodiazaborinine.
Molecular Properties
| Compound Name | 5-(4-chlorophenyl)-6H-pyrazolo[1,5-c][1,3,2]benzodiazaborinine |
| PubChem CID | 137278587 |
| Molecular Formula | C15H11BClN3 |
| Molecular Weight | 279.54 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 5-(4-chlorophenyl)-6H-pyrazolo[1,5-c][1,3,2]benzodiazaborinine |
| SMILES | Clc1ccc(B2Nc3ccccc3-c3ccnn32)cc1 |
| InChI | InChI=1S/C15H11BClN3/c17-12-7-5-11(6-8-12)16-19-14-4-2-1-3-13(14)15-9-10-18-20(15)16/h1-10,19H |
| InChIKey | PGMOFPGMJBGVQA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.54 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-chlorophenyl)-6H-pyrazolo[1,5-c][1,3,2]benzodiazaborinine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenyl)-6H-pyrazolo[1,5-c][1,3,2]benzodiazaborinine?
The IUPAC name of 5-(4-chlorophenyl)-6H-pyrazolo[1,5-c][1,3,2]benzodiazaborinine (CID 137278587) is 5-(4-chlorophenyl)-6H-pyrazolo[1,5-c][1,3,2]benzodiazaborinine.
What is the SMILES notation for 5-(4-chlorophenyl)-6H-pyrazolo[1,5-c][1,3,2]benzodiazaborinine?
The canonical SMILES for 5-(4-chlorophenyl)-6H-pyrazolo[1,5-c][1,3,2]benzodiazaborinine is Clc1ccc(B2Nc3ccccc3-c3ccnn32)cc1.
What is the InChIKey of 5-(4-chlorophenyl)-6H-pyrazolo[1,5-c][1,3,2]benzodiazaborinine?
The InChIKey is PGMOFPGMJBGVQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11BClN3/c17-12-7-5-11(6-8-12)16-19-14-4-2-1-3-13(14)15-9-10-18-20(15)16/h1-10,19H.
What are the key properties of 5-(4-chlorophenyl)-6H-pyrazolo[1,5-c][1,3,2]benzodiazaborinine?
5-(4-chlorophenyl)-6H-pyrazolo[1,5-c][1,3,2]benzodiazaborinine has a molecular weight of 279.54 g/mol, XLogP of 2.87, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenyl)-6H-pyrazolo[1,5-c][1,3,2]benzodiazaborinine is sourced from PubChem (CID 137278587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).