C21H25BClN3Si — CID 137278591
[5-chloro-2-(6H-pyrazolo[1,5-c][1,3,2]benzodiazaborinin-5-yl)phenyl]-triethylsilane (PubChem CID 137278591) has the molecular formula C21H25BClN3Si and a molecular weight of 393.80 g/mol. Its IUPAC name is [5-chloro-2-(6H-pyrazolo[1,5-c][1,3,2]benzodiazaborinin-5-yl)phenyl]-triethylsilane.
| Compound Name | [5-chloro-2-(6H-pyrazolo[1,5-c][1,3,2]benzodiazaborinin-5-yl)phenyl]-triethylsilane |
|---|---|
| PubChem CID | 137278591 |
| Molecular Formula | C21H25BClN3Si |
| Molecular Weight | 393.80 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | [5-chloro-2-(6H-pyrazolo[1,5-c][1,3,2]benzodiazaborinin-5-yl)phenyl]-triethylsilane |
| SMILES | CC[Si](CC)(CC)c1cc(Cl)ccc1B1Nc2ccccc2-c2ccnn21 |
| InChI | InChI=1S/C21H25BClN3Si/c1-4-27(5-2,6-3)21-15-16(23)11-12-18(21)22-25-19-10-8-7-9-17(19)20-13-14-24-26(20)22/h7-15,25H,4-6H2,1-3H3 |
| InChIKey | BAMCYASLACMCTO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.80 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|