C38H25IN4 — CID 137278666
(2Z,6Z,11Z,16Z)-19-iodo-2,7,12-triphenyl-18,22,23,24-tetrazahexacyclo[15.2.2.13,6.18,11.113,16.01,18]tetracosa-2,4,6,8(23),9,11,13(22),14,16,20-decaene (PubChem CID 137278666) has the molecular formula C38H25IN4 and a molecular weight of 664.55 g/mol. Its IUPAC name is (2Z,6Z,11Z,16Z)-19-iodo-2,7,12-triphenyl-18,22,23,24-tetrazahexacyclo[15.2.2.13,6.18,11.113,16.01,18]tetracosa-2,4,6,8(23),9,11,13(22),14,16,20-decaene.
| Compound Name | (2Z,6Z,11Z,16Z)-19-iodo-2,7,12-triphenyl-18,22,23,24-tetrazahexacyclo[15.2.2.13,6.18,11.113,16.01,18]tetracosa-2,4,6,8(23),9,11,13(22),14,16,20-decaene |
|---|---|
| PubChem CID | 137278666 |
| Molecular Formula | C38H25IN4 |
| Molecular Weight | 664.55 g/mol |
| Exact Mass | 664.11 |
| IUPAC Name | (2Z,6Z,11Z,16Z)-19-iodo-2,7,12-triphenyl-18,22,23,24-tetrazahexacyclo[15.2.2.13,6.18,11.113,16.01,18]tetracosa-2,4,6,8(23),9,11,13(22),14,16,20-decaene |
| SMILES | IC1N2/C3=C4/C=CC(=N4)/C(c4ccccc4)=C4/C=CC(=N4)/C(c4ccccc4)=c4/cc/c([nH]4)=C(\c4ccccc4)C12C=C3 |
| InChI | InChI=1S/C38H25IN4/c39-37-38-23-22-33(43(37)38)27-16-17-28(40-27)34(24-10-4-1-5-11-24)29-18-19-30(41-29)35(25-12-6-2-7-13-25)31-20-21-32(42-31)36(38)26-14-8-3-9-15-26/h1-23,37,42H/b33-27-,34-29-,35-31-,36-32- |
| InChIKey | RAYIAPMKEIGGGT-YUDJSTIVSA-N |
| XLogP | 6.46 |
| TPSA | 43.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.55 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|