C23H28N6O3S — CID 137279374
methyl 4-[5-(1,3-benzothiazol-2-yl)-6-oxo-4-[(3R)-piperidin-3-yl]imino-1H-pyrimidin-2-yl]piperidine-1-carboxylate (PubChem CID 137279374) has the molecular formula C23H28N6O3S and a molecular weight of 468.58 g/mol. Its IUPAC name is methyl 4-[5-(1,3-benzothiazol-2-yl)-6-oxo-4-[(3R)-piperidin-3-yl]imino-1H-pyrimidin-2-yl]piperidine-1-carboxylate.
| Compound Name | methyl 4-[5-(1,3-benzothiazol-2-yl)-6-oxo-4-[(3R)-piperidin-3-yl]imino-1H-pyrimidin-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 137279374 |
| Molecular Formula | C23H28N6O3S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | methyl 4-[5-(1,3-benzothiazol-2-yl)-6-oxo-4-[(3R)-piperidin-3-yl]imino-1H-pyrimidin-2-yl]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(C2=N/C(=N\[C@@H]3CCCNC3)C(c3nc4ccccc4s3)C(=O)N2)CC1 |
| InChI | InChI=1S/C23H28N6O3S/c1-32-23(31)29-11-8-14(9-12-29)19-27-20(25-15-5-4-10-24-13-15)18(21(30)28-19)22-26-16-6-2-3-7-17(16)33-22/h2-3,6-7,14-15,18,24H,4-5,8-13H2,1H3,(H,25,27,28,30)/t15-,18?/m1/s1 |
| InChIKey | NXPJPZSFRQLAMS-NNJIEVJOSA-N |
| XLogP | 2.54 |
| TPSA | 108.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|