About gold(1+);(1S)-1-(2-methoxyprop-2-enyl)-2-propylidenecyclohexane
gold(1+);(1S)-1-(2-methoxyprop-2-enyl)-2-propylidenecyclohexane (PubChem CID 137279623) has the molecular formula C13H20AuO+
and a molecular weight of 389.27 g/mol. Its IUPAC name is gold(1+);(1S)-1-(2-methoxyprop-2-enyl)-2-propylidenecyclohexane.
Molecular Properties
| Compound Name | gold(1+);(1S)-1-(2-methoxyprop-2-enyl)-2-propylidenecyclohexane |
| PubChem CID | 137279623 |
| Molecular Formula | C13H20AuO+ |
| Molecular Weight | 389.27 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | gold(1+);(1S)-1-(2-methoxyprop-2-enyl)-2-propylidenecyclohexane |
| SMILES | [Au+].[H]/[C-]=C(\C[C@@H]1CCCCC1=C[CH+]C)OC |
| InChI | InChI=1S/C13H20O.Au/c1-4-7-12-8-5-6-9-13(12)10-11(2)14-3;/h2,4,7,13H,5-6,8-10H2,1,3H3;/q;+1/t13-;/m0./s1 |
| InChIKey | TXOIRFSPEWIYKQ-ZOWNYOTGSA-N |
| XLogP | 3.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.27 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze gold(1+);(1S)-1-(2-methoxyprop-2-enyl)-2-propylidenecyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold(1+);(1S)-1-(2-methoxyprop-2-enyl)-2-propylidenecyclohexane?
The IUPAC name of gold(1+);(1S)-1-(2-methoxyprop-2-enyl)-2-propylidenecyclohexane (CID 137279623) is gold(1+);(1S)-1-(2-methoxyprop-2-enyl)-2-propylidenecyclohexane.
What is the SMILES notation for gold(1+);(1S)-1-(2-methoxyprop-2-enyl)-2-propylidenecyclohexane?
The canonical SMILES for gold(1+);(1S)-1-(2-methoxyprop-2-enyl)-2-propylidenecyclohexane is [Au+].[H]/[C-]=C(\C[C@@H]1CCCCC1=C[CH+]C)OC.
What is the InChIKey of gold(1+);(1S)-1-(2-methoxyprop-2-enyl)-2-propylidenecyclohexane?
The InChIKey is TXOIRFSPEWIYKQ-ZOWNYOTGSA-N. The full InChI is InChI=1S/C13H20O.Au/c1-4-7-12-8-5-6-9-13(12)10-11(2)14-3;/h2,4,7,13H,5-6,8-10H2,1,3H3;/q;+1/t13-;/m0./s1.
What are the key properties of gold(1+);(1S)-1-(2-methoxyprop-2-enyl)-2-propylidenecyclohexane?
gold(1+);(1S)-1-(2-methoxyprop-2-enyl)-2-propylidenecyclohexane has a molecular weight of 389.27 g/mol, XLogP of 3.68, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for gold(1+);(1S)-1-(2-methoxyprop-2-enyl)-2-propylidenecyclohexane is sourced from PubChem (CID 137279623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).