C22H24F3N5O2S — CID 137279792
N,N'-diamino-4-(5-ethylthiophen-2-yl)-2-oxo-6-[4-(4,4,4-trifluorobutoxy)phenyl]-1H-pyridine-3-carboximidamide (PubChem CID 137279792) has the molecular formula C22H24F3N5O2S and a molecular weight of 479.53 g/mol. Its IUPAC name is N,N'-diamino-4-(5-ethylthiophen-2-yl)-2-oxo-6-[4-(4,4,4-trifluorobutoxy)phenyl]-1H-pyridine-3-carboximidamide.
| Compound Name | N,N'-diamino-4-(5-ethylthiophen-2-yl)-2-oxo-6-[4-(4,4,4-trifluorobutoxy)phenyl]-1H-pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 137279792 |
| Molecular Formula | C22H24F3N5O2S |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | N,N'-diamino-4-(5-ethylthiophen-2-yl)-2-oxo-6-[4-(4,4,4-trifluorobutoxy)phenyl]-1H-pyridine-3-carboximidamide |
| SMILES | CCc1ccc(-c2cc(-c3ccc(OCCCC(F)(F)F)cc3)[nH]c(=O)c2/C(=N/N)NN)s1 |
| InChI | InChI=1S/C22H24F3N5O2S/c1-2-15-8-9-18(33-15)16-12-17(28-21(31)19(16)20(29-26)30-27)13-4-6-14(7-5-13)32-11-3-10-22(23,24)25/h4-9,12H,2-3,10-11,26-27H2,1H3,(H,28,31)(H,29,30) |
| InChIKey | AURXJTOELNYYOP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|