C21H22F3N7O — CID 137279828
4-(1-methylpyrazol-3-yl)-3-(2H-tetrazol-5-yl)-6-[4-(5,5,5-trifluoropentyl)phenyl]-1,2-dihydropyridin-2-ol (PubChem CID 137279828) has the molecular formula C21H22F3N7O and a molecular weight of 445.45 g/mol. Its IUPAC name is 4-(1-methylpyrazol-3-yl)-3-(2H-tetrazol-5-yl)-6-[4-(5,5,5-trifluoropentyl)phenyl]-1,2-dihydropyridin-2-ol.
| Compound Name | 4-(1-methylpyrazol-3-yl)-3-(2H-tetrazol-5-yl)-6-[4-(5,5,5-trifluoropentyl)phenyl]-1,2-dihydropyridin-2-ol |
|---|---|
| PubChem CID | 137279828 |
| Molecular Formula | C21H22F3N7O |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 4-(1-methylpyrazol-3-yl)-3-(2H-tetrazol-5-yl)-6-[4-(5,5,5-trifluoropentyl)phenyl]-1,2-dihydropyridin-2-ol |
| SMILES | Cn1ccc(C2=C(c3nn[nH]n3)C(O)NC(c3ccc(CCCCC(F)(F)F)cc3)=C2)n1 |
| InChI | InChI=1S/C21H22F3N7O/c1-31-11-9-16(28-31)15-12-17(25-20(32)18(15)19-26-29-30-27-19)14-7-5-13(6-8-14)4-2-3-10-21(22,23)24/h5-9,11-12,20,25,32H,2-4,10H2,1H3,(H,26,27,29,30) |
| InChIKey | VVLYNDDTZQVOPN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|