About N,N-dimethyl-2,2-diphenylacetamide
N,N-dimethyl-2,2-diphenylacetamide (PubChem CID 13728) has the molecular formula C16H17NO
and a molecular weight of 239.32 g/mol. Its IUPAC name is N,N-dimethyl-2,2-diphenylacetamide.
Molecular Properties
| Compound Name | N,N-dimethyl-2,2-diphenylacetamide |
| PubChem CID | 13728 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | N,N-dimethyl-2,2-diphenylacetamide |
| SMILES | CN(C)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H17NO/c1-17(2)16(18)15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12,15H,1-2H3 |
| InChIKey | QAHFOPIILNICLA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dimethyl-2,2-diphenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-2,2-diphenylacetamide?
The IUPAC name of N,N-dimethyl-2,2-diphenylacetamide (CID 13728) is N,N-dimethyl-2,2-diphenylacetamide.
What is the SMILES notation for N,N-dimethyl-2,2-diphenylacetamide?
The canonical SMILES for N,N-dimethyl-2,2-diphenylacetamide is CN(C)C(=O)C(c1ccccc1)c1ccccc1.
What is the InChIKey of N,N-dimethyl-2,2-diphenylacetamide?
The InChIKey is QAHFOPIILNICLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO/c1-17(2)16(18)15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12,15H,1-2H3.
What are the key properties of N,N-dimethyl-2,2-diphenylacetamide?
N,N-dimethyl-2,2-diphenylacetamide has a molecular weight of 239.32 g/mol, XLogP of 2.91, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-2,2-diphenylacetamide is sourced from PubChem (CID 13728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).