C16H12BrFN6O3 — CID 137280146
1-[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]-3-phenylurea (PubChem CID 137280146) has the molecular formula C16H12BrFN6O3 and a molecular weight of 435.21 g/mol. Its IUPAC name is 1-[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]-3-phenylurea.
| Compound Name | 1-[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]-3-phenylurea |
|---|---|
| PubChem CID | 137280146 |
| Molecular Formula | C16H12BrFN6O3 |
| Molecular Weight | 435.21 g/mol |
| Exact Mass | 434.01 |
| IUPAC Name | 1-[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C16H12BrFN6O3/c17-11-8-10(6-7-12(11)18)19-14(22-26)13-15(24-27-23-13)21-16(25)20-9-4-2-1-3-5-9/h1-8,26H,(H,19,22)(H2,20,21,24,25) |
| InChIKey | FLBRYIQWRZLEGM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 124.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.21 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|