C13H17N5O — CID 137280904
3-cyano-N,N,6-trimethyl-4-oxo-1,6,7,8-tetrahydropyrido[1,2-a]pyrimidine-9-carboximidamide (PubChem CID 137280904) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is 3-cyano-N,N,6-trimethyl-4-oxo-1,6,7,8-tetrahydropyrido[1,2-a]pyrimidine-9-carboximidamide.
| Compound Name | 3-cyano-N,N,6-trimethyl-4-oxo-1,6,7,8-tetrahydropyrido[1,2-a]pyrimidine-9-carboximidamide |
|---|---|
| PubChem CID | 137280904 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 3-cyano-N,N,6-trimethyl-4-oxo-1,6,7,8-tetrahydropyrido[1,2-a]pyrimidine-9-carboximidamide |
| SMILES | [H]/N=C(/C1=C2NC=C(C#N)C(=O)N2C(C)CC1)N(C)C |
| InChI | InChI=1S/C13H17N5O/c1-8-4-5-10(11(15)17(2)3)12-16-7-9(6-14)13(19)18(8)12/h7-8,15-16H,4-5H2,1-3H3/b15-11- |
| InChIKey | JDMCLROHBBBKFI-PTNGSMBKSA-N |
| XLogP | 0.76 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|