C15H22N4O3 — CID 137280918
ethyl 9-(N,N-dimethylcarbamimidoyl)-6-methyl-4-oxo-1,6,7,8-tetrahydropyrido[1,2-a]pyrimidine-3-carboxylate (PubChem CID 137280918) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is ethyl 9-(N,N-dimethylcarbamimidoyl)-6-methyl-4-oxo-1,6,7,8-tetrahydropyrido[1,2-a]pyrimidine-3-carboxylate.
| Compound Name | ethyl 9-(N,N-dimethylcarbamimidoyl)-6-methyl-4-oxo-1,6,7,8-tetrahydropyrido[1,2-a]pyrimidine-3-carboxylate |
|---|---|
| PubChem CID | 137280918 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | ethyl 9-(N,N-dimethylcarbamimidoyl)-6-methyl-4-oxo-1,6,7,8-tetrahydropyrido[1,2-a]pyrimidine-3-carboxylate |
| SMILES | [H]/N=C(/C1=C2NC=C(C(=O)OCC)C(=O)N2C(C)CC1)N(C)C |
| InChI | InChI=1S/C15H22N4O3/c1-5-22-15(21)11-8-17-13-10(12(16)18(3)4)7-6-9(2)19(13)14(11)20/h8-9,16-17H,5-7H2,1-4H3/b16-12- |
| InChIKey | ITTPSDAYCCFVAS-VBKFSLOCSA-N |
| XLogP | 0.80 |
| TPSA | 85.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|