C21H21N7O2 — CID 137281126
N-[(4-oxo-3H-quinazolin-2-yl)methyl]-2-(5-phenyltetrazol-2-yl)-N-propan-2-ylacetamide (PubChem CID 137281126) has the molecular formula C21H21N7O2 and a molecular weight of 403.45 g/mol. Its IUPAC name is N-[(4-oxo-3H-quinazolin-2-yl)methyl]-2-(5-phenyltetrazol-2-yl)-N-propan-2-ylacetamide.
| Compound Name | N-[(4-oxo-3H-quinazolin-2-yl)methyl]-2-(5-phenyltetrazol-2-yl)-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 137281126 |
| Molecular Formula | C21H21N7O2 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | N-[(4-oxo-3H-quinazolin-2-yl)methyl]-2-(5-phenyltetrazol-2-yl)-N-propan-2-ylacetamide |
| SMILES | CC(C)N(Cc1nc2ccccc2c(=O)[nH]1)C(=O)Cn1nnc(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H21N7O2/c1-14(2)27(12-18-22-17-11-7-6-10-16(17)21(30)23-18)19(29)13-28-25-20(24-26-28)15-8-4-3-5-9-15/h3-11,14H,12-13H2,1-2H3,(H,22,23,30) |
| InChIKey | BISAFXHYLXGPFZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |