C26H26N6O — CID 137281395
cyclohexyl-[[5-[3-(1H-pyrrolo[3,2-c]pyridin-2-yl)-1H-indazol-5-yl]-3-pyridinyl]amino]methanol (PubChem CID 137281395) has the molecular formula C26H26N6O and a molecular weight of 438.54 g/mol. Its IUPAC name is cyclohexyl-[[5-[3-(1H-pyrrolo[3,2-c]pyridin-2-yl)-1H-indazol-5-yl]-3-pyridinyl]amino]methanol.
| Compound Name | cyclohexyl-[[5-[3-(1H-pyrrolo[3,2-c]pyridin-2-yl)-1H-indazol-5-yl]-3-pyridinyl]amino]methanol |
|---|---|
| PubChem CID | 137281395 |
| Molecular Formula | C26H26N6O |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | cyclohexyl-[[5-[3-(1H-pyrrolo[3,2-c]pyridin-2-yl)-1H-indazol-5-yl]-3-pyridinyl]amino]methanol |
| SMILES | OC(Nc1cncc(-c2ccc3[nH]nc(-c4cc5cnccc5[nH]4)c3c2)c1)C1CCCCC1 |
| InChI | InChI=1S/C26H26N6O/c33-26(16-4-2-1-3-5-16)29-20-10-18(13-28-15-20)17-6-7-23-21(11-17)25(32-31-23)24-12-19-14-27-9-8-22(19)30-24/h6-16,26,29-30,33H,1-5H2,(H,31,32) |
| InChIKey | VMBDNXUTMRLFGN-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|