C7H13N5 — CID 137282317
(Z)-3-[[(1E,3Z)-1,4-diaminobuta-1,3-dien-2-yl]amino]prop-2-enimidamide (PubChem CID 137282317) has the molecular formula C7H13N5 and a molecular weight of 167.22 g/mol. Its IUPAC name is (Z)-3-[[(1E,3Z)-1,4-diaminobuta-1,3-dien-2-yl]amino]prop-2-enimidamide.
| Compound Name | (Z)-3-[[(1E,3Z)-1,4-diaminobuta-1,3-dien-2-yl]amino]prop-2-enimidamide |
|---|---|
| PubChem CID | 137282317 |
| Molecular Formula | C7H13N5 |
| Molecular Weight | 167.22 g/mol |
| Exact Mass | 167.12 |
| IUPAC Name | (Z)-3-[[(1E,3Z)-1,4-diaminobuta-1,3-dien-2-yl]amino]prop-2-enimidamide |
| SMILES | [H]/N=C(N)/C=C\NC(/C=C\N)=C/N |
| InChI | InChI=1S/C7H13N5/c8-3-1-6(5-9)12-4-2-7(10)11/h1-5,12H,8-9H2,(H3,10,11)/b3-1-,4-2-,6-5+ |
| InChIKey | MNDCGXFKJKZUJG-ARJLTWGPSA-N |
| XLogP | -0.70 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.22 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|