About (Z)-3-[[(2E)-penta-2,4-dien-2-yl]amino]prop-2-enimidamide
(Z)-3-[[(2E)-penta-2,4-dien-2-yl]amino]prop-2-enimidamide (PubChem CID 137282355) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is (Z)-3-[[(2E)-penta-2,4-dien-2-yl]amino]prop-2-enimidamide.
Molecular Properties
| Compound Name | (Z)-3-[[(2E)-penta-2,4-dien-2-yl]amino]prop-2-enimidamide |
| PubChem CID | 137282355 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | (Z)-3-[[(2E)-penta-2,4-dien-2-yl]amino]prop-2-enimidamide |
| SMILES | [H]/N=C(N)/C=C\N/C(C)=C/C=C |
| InChI | InChI=1S/C8H13N3/c1-3-4-7(2)11-6-5-8(9)10/h3-6,11H,1H2,2H3,(H3,9,10)/b6-5-,7-4+ |
| InChIKey | FLSQPIOYALNBSQ-IUQJDUBZSA-N |
| XLogP | 1.12 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-[[(2E)-penta-2,4-dien-2-yl]amino]prop-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-[[(2E)-penta-2,4-dien-2-yl]amino]prop-2-enimidamide?
The IUPAC name of (Z)-3-[[(2E)-penta-2,4-dien-2-yl]amino]prop-2-enimidamide (CID 137282355) is (Z)-3-[[(2E)-penta-2,4-dien-2-yl]amino]prop-2-enimidamide.
What is the SMILES notation for (Z)-3-[[(2E)-penta-2,4-dien-2-yl]amino]prop-2-enimidamide?
The canonical SMILES for (Z)-3-[[(2E)-penta-2,4-dien-2-yl]amino]prop-2-enimidamide is [H]/N=C(N)/C=C\N/C(C)=C/C=C.
What is the InChIKey of (Z)-3-[[(2E)-penta-2,4-dien-2-yl]amino]prop-2-enimidamide?
The InChIKey is FLSQPIOYALNBSQ-IUQJDUBZSA-N. The full InChI is InChI=1S/C8H13N3/c1-3-4-7(2)11-6-5-8(9)10/h3-6,11H,1H2,2H3,(H3,9,10)/b6-5-,7-4+.
What are the key properties of (Z)-3-[[(2E)-penta-2,4-dien-2-yl]amino]prop-2-enimidamide?
(Z)-3-[[(2E)-penta-2,4-dien-2-yl]amino]prop-2-enimidamide has a molecular weight of 151.21 g/mol, XLogP of 1.12, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-[[(2E)-penta-2,4-dien-2-yl]amino]prop-2-enimidamide is sourced from PubChem (CID 137282355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).