About (2S)-2-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-methyl-1-piperidin-1-ylbutan-1-one
(2S)-2-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-methyl-1-piperidin-1-ylbutan-1-one (PubChem CID 137282738) has the molecular formula C17H22Br2N2O2
and a molecular weight of 446.18 g/mol. Its IUPAC name is (2S)-2-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-methyl-1-piperidin-1-ylbutan-1-one.
Molecular Properties
| Compound Name | (2S)-2-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-methyl-1-piperidin-1-ylbutan-1-one |
| PubChem CID | 137282738 |
| Molecular Formula | C17H22Br2N2O2 |
| Molecular Weight | 446.18 g/mol |
| Exact Mass | 444.00 |
| IUPAC Name | (2S)-2-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-methyl-1-piperidin-1-ylbutan-1-one |
| SMILES | CC(C)[C@H](/N=C/c1cc(Br)cc(Br)c1O)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C17H22Br2N2O2/c1-11(2)15(17(23)21-6-4-3-5-7-21)20-10-12-8-13(18)9-14(19)16(12)22/h8-11,15,22H,3-7H2,1-2H3/b20-10+/t15-/m0/s1 |
| InChIKey | NNDJYRGVXJNWAB-VYXQJKENSA-N |
| XLogP | 4.37 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.18 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-methyl-1-piperidin-1-ylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-methyl-1-piperidin-1-ylbutan-1-one?
The IUPAC name of (2S)-2-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-methyl-1-piperidin-1-ylbutan-1-one (CID 137282738) is (2S)-2-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-methyl-1-piperidin-1-ylbutan-1-one.
What is the SMILES notation for (2S)-2-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-methyl-1-piperidin-1-ylbutan-1-one?
The canonical SMILES for (2S)-2-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-methyl-1-piperidin-1-ylbutan-1-one is CC(C)[C@H](/N=C/c1cc(Br)cc(Br)c1O)C(=O)N1CCCCC1.
What is the InChIKey of (2S)-2-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-methyl-1-piperidin-1-ylbutan-1-one?
The InChIKey is NNDJYRGVXJNWAB-VYXQJKENSA-N. The full InChI is InChI=1S/C17H22Br2N2O2/c1-11(2)15(17(23)21-6-4-3-5-7-21)20-10-12-8-13(18)9-14(19)16(12)22/h8-11,15,22H,3-7H2,1-2H3/b20-10+/t15-/m0/s1.
What are the key properties of (2S)-2-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-methyl-1-piperidin-1-ylbutan-1-one?
(2S)-2-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-methyl-1-piperidin-1-ylbutan-1-one has a molecular weight of 446.18 g/mol, XLogP of 4.37, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-methyl-1-piperidin-1-ylbutan-1-one is sourced from PubChem (CID 137282738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).