About 2-phenyl-N-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]acetamide
2-phenyl-N-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]acetamide (PubChem CID 137283404) has the molecular formula C15H14N2O4
and a molecular weight of 286.29 g/mol. Its IUPAC name is 2-phenyl-N-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]acetamide.
Molecular Properties
| Compound Name | 2-phenyl-N-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]acetamide |
| PubChem CID | 137283404 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 2-phenyl-N-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]acetamide |
| SMILES | O=C(Cc1ccccc1)N/N=C/c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C15H14N2O4/c18-12-7-6-11(14(20)15(12)21)9-16-17-13(19)8-10-4-2-1-3-5-10/h1-7,9,18,20-21H,8H2,(H,17,19)/b16-9+ |
| InChIKey | JCTOGMJBKBAGRI-CXUHLZMHSA-N |
| XLogP | 1.50 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-phenyl-N-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-N-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]acetamide?
The IUPAC name of 2-phenyl-N-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]acetamide (CID 137283404) is 2-phenyl-N-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]acetamide.
What is the SMILES notation for 2-phenyl-N-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]acetamide?
The canonical SMILES for 2-phenyl-N-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]acetamide is O=C(Cc1ccccc1)N/N=C/c1ccc(O)c(O)c1O.
What is the InChIKey of 2-phenyl-N-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]acetamide?
The InChIKey is JCTOGMJBKBAGRI-CXUHLZMHSA-N. The full InChI is InChI=1S/C15H14N2O4/c18-12-7-6-11(14(20)15(12)21)9-16-17-13(19)8-10-4-2-1-3-5-10/h1-7,9,18,20-21H,8H2,(H,17,19)/b16-9+.
What are the key properties of 2-phenyl-N-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]acetamide?
2-phenyl-N-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]acetamide has a molecular weight of 286.29 g/mol, XLogP of 1.50, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-N-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]acetamide is sourced from PubChem (CID 137283404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).