About (Z)-3-(3,4-dihydroxy-5-nitrophenyl)-2-pyridin-4-ylprop-2-enenitrile
(Z)-3-(3,4-dihydroxy-5-nitrophenyl)-2-pyridin-4-ylprop-2-enenitrile (PubChem CID 137283539) has the molecular formula C14H9N3O4
and a molecular weight of 283.24 g/mol. Its IUPAC name is (Z)-3-(3,4-dihydroxy-5-nitrophenyl)-2-pyridin-4-ylprop-2-enenitrile.
Molecular Properties
| Compound Name | (Z)-3-(3,4-dihydroxy-5-nitrophenyl)-2-pyridin-4-ylprop-2-enenitrile |
| PubChem CID | 137283539 |
| Molecular Formula | C14H9N3O4 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | (Z)-3-(3,4-dihydroxy-5-nitrophenyl)-2-pyridin-4-ylprop-2-enenitrile |
| SMILES | N#C/C(=C\c1cc(O)c(O)c([N+](=O)[O-])c1)c1ccncc1 |
| InChI | InChI=1S/C14H9N3O4/c15-8-11(10-1-3-16-4-2-10)5-9-6-12(17(20)21)14(19)13(18)7-9/h1-7,18-19H/b11-5+ |
| InChIKey | FAWNSBSSVYMXHO-VZUCSPMQSA-N |
| XLogP | 2.47 |
| TPSA | 120.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-(3,4-dihydroxy-5-nitrophenyl)-2-pyridin-4-ylprop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-(3,4-dihydroxy-5-nitrophenyl)-2-pyridin-4-ylprop-2-enenitrile?
The IUPAC name of (Z)-3-(3,4-dihydroxy-5-nitrophenyl)-2-pyridin-4-ylprop-2-enenitrile (CID 137283539) is (Z)-3-(3,4-dihydroxy-5-nitrophenyl)-2-pyridin-4-ylprop-2-enenitrile.
What is the SMILES notation for (Z)-3-(3,4-dihydroxy-5-nitrophenyl)-2-pyridin-4-ylprop-2-enenitrile?
The canonical SMILES for (Z)-3-(3,4-dihydroxy-5-nitrophenyl)-2-pyridin-4-ylprop-2-enenitrile is N#C/C(=C\c1cc(O)c(O)c([N+](=O)[O-])c1)c1ccncc1.
What is the InChIKey of (Z)-3-(3,4-dihydroxy-5-nitrophenyl)-2-pyridin-4-ylprop-2-enenitrile?
The InChIKey is FAWNSBSSVYMXHO-VZUCSPMQSA-N. The full InChI is InChI=1S/C14H9N3O4/c15-8-11(10-1-3-16-4-2-10)5-9-6-12(17(20)21)14(19)13(18)7-9/h1-7,18-19H/b11-5+.
What are the key properties of (Z)-3-(3,4-dihydroxy-5-nitrophenyl)-2-pyridin-4-ylprop-2-enenitrile?
(Z)-3-(3,4-dihydroxy-5-nitrophenyl)-2-pyridin-4-ylprop-2-enenitrile has a molecular weight of 283.24 g/mol, XLogP of 2.47, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-(3,4-dihydroxy-5-nitrophenyl)-2-pyridin-4-ylprop-2-enenitrile is sourced from PubChem (CID 137283539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).