C9H16N2O — CID 137284475
(NE)-N-[2-[(E)-prop-1-enyl]iminohexan-3-ylidene]hydroxylamine (PubChem CID 137284475) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is (NE)-N-[2-[(E)-prop-1-enyl]iminohexan-3-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[2-[(E)-prop-1-enyl]iminohexan-3-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 137284475 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | (NE)-N-[2-[(E)-prop-1-enyl]iminohexan-3-ylidene]hydroxylamine |
| SMILES | C/C=C/N=C(C)/C(CCC)=N/O |
| InChI | InChI=1S/C9H16N2O/c1-4-6-9(11-12)8(3)10-7-5-2/h5,7,12H,4,6H2,1-3H3/b7-5+,10-8+,11-9+ |
| InChIKey | IISQAPIBJYFSEW-HJHGIKLDSA-N |
| XLogP | 2.61 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|