C22H29N5 — CID 137285052
4-[2-[(2E,4Z)-5-aminopenta-2,4-dien-2-yl]-6-methyl-4-methylimino-2,3,7,8-tetrahydro-1H-quinazolin-7-yl]cyclohex-3-ene-1-carbonitrile (PubChem CID 137285052) has the molecular formula C22H29N5 and a molecular weight of 363.51 g/mol. Its IUPAC name is 4-[2-[(2E,4Z)-5-aminopenta-2,4-dien-2-yl]-6-methyl-4-methylimino-2,3,7,8-tetrahydro-1H-quinazolin-7-yl]cyclohex-3-ene-1-carbonitrile.
| Compound Name | 4-[2-[(2E,4Z)-5-aminopenta-2,4-dien-2-yl]-6-methyl-4-methylimino-2,3,7,8-tetrahydro-1H-quinazolin-7-yl]cyclohex-3-ene-1-carbonitrile |
|---|---|
| PubChem CID | 137285052 |
| Molecular Formula | C22H29N5 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 4-[2-[(2E,4Z)-5-aminopenta-2,4-dien-2-yl]-6-methyl-4-methylimino-2,3,7,8-tetrahydro-1H-quinazolin-7-yl]cyclohex-3-ene-1-carbonitrile |
| SMILES | C/N=C1\NC(/C(C)=C/C=C\N)NC2=C1C=C(C)C(C1=CCC(C#N)CC1)C2 |
| InChI | InChI=1S/C22H29N5/c1-14(5-4-10-23)21-26-20-12-18(17-8-6-16(13-24)7-9-17)15(2)11-19(20)22(25-3)27-21/h4-5,8,10-11,16,18,21,26H,6-7,9,12,23H2,1-3H3,(H,25,27)/b10-4-,14-5+ |
| InChIKey | DTJLQZUVWUTJGY-SENWVQMDSA-N |
| XLogP | 3.42 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|