About 5-hydroxy-3,8-dimethyl-2-phenoxy-1,7-naphthyridine-6-carboxylic acid
5-hydroxy-3,8-dimethyl-2-phenoxy-1,7-naphthyridine-6-carboxylic acid (PubChem CID 137285330) has the molecular formula C17H14N2O4
and a molecular weight of 310.31 g/mol. Its IUPAC name is 5-hydroxy-3,8-dimethyl-2-phenoxy-1,7-naphthyridine-6-carboxylic acid.
Molecular Properties
| Compound Name | 5-hydroxy-3,8-dimethyl-2-phenoxy-1,7-naphthyridine-6-carboxylic acid |
| PubChem CID | 137285330 |
| Molecular Formula | C17H14N2O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 5-hydroxy-3,8-dimethyl-2-phenoxy-1,7-naphthyridine-6-carboxylic acid |
| SMILES | Cc1cc2c(O)c(C(=O)O)nc(C)c2nc1Oc1ccccc1 |
| InChI | InChI=1S/C17H14N2O4/c1-9-8-12-13(10(2)18-14(15(12)20)17(21)22)19-16(9)23-11-6-4-3-5-7-11/h3-8,20H,1-2H3,(H,21,22) |
| InChIKey | XAQJJMVWHHOTGC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 92.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-hydroxy-3,8-dimethyl-2-phenoxy-1,7-naphthyridine-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-3,8-dimethyl-2-phenoxy-1,7-naphthyridine-6-carboxylic acid?
The IUPAC name of 5-hydroxy-3,8-dimethyl-2-phenoxy-1,7-naphthyridine-6-carboxylic acid (CID 137285330) is 5-hydroxy-3,8-dimethyl-2-phenoxy-1,7-naphthyridine-6-carboxylic acid.
What is the SMILES notation for 5-hydroxy-3,8-dimethyl-2-phenoxy-1,7-naphthyridine-6-carboxylic acid?
The canonical SMILES for 5-hydroxy-3,8-dimethyl-2-phenoxy-1,7-naphthyridine-6-carboxylic acid is Cc1cc2c(O)c(C(=O)O)nc(C)c2nc1Oc1ccccc1.
What is the InChIKey of 5-hydroxy-3,8-dimethyl-2-phenoxy-1,7-naphthyridine-6-carboxylic acid?
The InChIKey is XAQJJMVWHHOTGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O4/c1-9-8-12-13(10(2)18-14(15(12)20)17(21)22)19-16(9)23-11-6-4-3-5-7-11/h3-8,20H,1-2H3,(H,21,22).
What are the key properties of 5-hydroxy-3,8-dimethyl-2-phenoxy-1,7-naphthyridine-6-carboxylic acid?
5-hydroxy-3,8-dimethyl-2-phenoxy-1,7-naphthyridine-6-carboxylic acid has a molecular weight of 310.31 g/mol, XLogP of 3.44, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-3,8-dimethyl-2-phenoxy-1,7-naphthyridine-6-carboxylic acid is sourced from PubChem (CID 137285330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).