C22H15FN4O2 — CID 137285352
8-(6-fluoro-3-pyridinyl)-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-ol (PubChem CID 137285352) has the molecular formula C22H15FN4O2 and a molecular weight of 386.39 g/mol. Its IUPAC name is 8-(6-fluoro-3-pyridinyl)-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-ol.
| Compound Name | 8-(6-fluoro-3-pyridinyl)-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-ol |
|---|---|
| PubChem CID | 137285352 |
| Molecular Formula | C22H15FN4O2 |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 8-(6-fluoro-3-pyridinyl)-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-ol |
| SMILES | Oc1c(Cc2ccco2)nc2c(-c3ccc(F)nc3)nc(-c3ccccc3)cn12 |
| InChI | InChI=1S/C22H15FN4O2/c23-19-9-8-15(12-24-19)20-21-26-17(11-16-7-4-10-29-16)22(28)27(21)13-18(25-20)14-5-2-1-3-6-14/h1-10,12-13,28H,11H2 |
| InChIKey | NAGSPJWNYNYXHZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 76.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|