C20H13FN4O2S — CID 137285373
8-(2-fluoro-4-pyridinyl)-2-(furan-2-ylmethyl)-6-thiophen-2-ylimidazo[1,2-a]pyrazin-3-ol (PubChem CID 137285373) has the molecular formula C20H13FN4O2S and a molecular weight of 392.42 g/mol. Its IUPAC name is 8-(2-fluoro-4-pyridinyl)-2-(furan-2-ylmethyl)-6-thiophen-2-ylimidazo[1,2-a]pyrazin-3-ol.
| Compound Name | 8-(2-fluoro-4-pyridinyl)-2-(furan-2-ylmethyl)-6-thiophen-2-ylimidazo[1,2-a]pyrazin-3-ol |
|---|---|
| PubChem CID | 137285373 |
| Molecular Formula | C20H13FN4O2S |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 8-(2-fluoro-4-pyridinyl)-2-(furan-2-ylmethyl)-6-thiophen-2-ylimidazo[1,2-a]pyrazin-3-ol |
| SMILES | Oc1c(Cc2ccco2)nc2c(-c3ccnc(F)c3)nc(-c3cccs3)cn12 |
| InChI | InChI=1S/C20H13FN4O2S/c21-17-9-12(5-6-22-17)18-19-24-14(10-13-3-1-7-27-13)20(26)25(19)11-15(23-18)16-4-2-8-28-16/h1-9,11,26H,10H2 |
| InChIKey | HLCPZCHWGCVCHV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 76.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|