C24H20N4O2 — CID 137285428
6-(3-aminophenyl)-8-benzyl-2-(furan-2-ylmethyl)imidazo[1,2-a]pyrazin-3-ol (PubChem CID 137285428) has the molecular formula C24H20N4O2 and a molecular weight of 396.45 g/mol. Its IUPAC name is 6-(3-aminophenyl)-8-benzyl-2-(furan-2-ylmethyl)imidazo[1,2-a]pyrazin-3-ol.
| Compound Name | 6-(3-aminophenyl)-8-benzyl-2-(furan-2-ylmethyl)imidazo[1,2-a]pyrazin-3-ol |
|---|---|
| PubChem CID | 137285428 |
| Molecular Formula | C24H20N4O2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 6-(3-aminophenyl)-8-benzyl-2-(furan-2-ylmethyl)imidazo[1,2-a]pyrazin-3-ol |
| SMILES | Nc1cccc(-c2cn3c(O)c(Cc4ccco4)nc3c(Cc3ccccc3)n2)c1 |
| InChI | InChI=1S/C24H20N4O2/c25-18-9-4-8-17(13-18)22-15-28-23(20(26-22)12-16-6-2-1-3-7-16)27-21(24(28)29)14-19-10-5-11-30-19/h1-11,13,15,29H,12,14,25H2 |
| InChIKey | ROFAKKUMBJWAHH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 89.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|