C14H12N2O4 — CID 137285476
N-[(E)-(2,4,6-trihydroxyphenyl)methylideneamino]benzamide (PubChem CID 137285476) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is N-[(E)-(2,4,6-trihydroxyphenyl)methylideneamino]benzamide.
| Compound Name | N-[(E)-(2,4,6-trihydroxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 137285476 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | N-[(E)-(2,4,6-trihydroxyphenyl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1c(O)cc(O)cc1O)c1ccccc1 |
| InChI | InChI=1S/C14H12N2O4/c17-10-6-12(18)11(13(19)7-10)8-15-16-14(20)9-4-2-1-3-5-9/h1-8,17-19H,(H,16,20)/b15-8+ |
| InChIKey | PELXFMRYWGXDSK-OVCLIPMQSA-N |
| XLogP | 1.57 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|