About cobalt;2-[2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]ethyliminomethyl]-6-methoxyphenol
cobalt;2-[2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]ethyliminomethyl]-6-methoxyphenol (PubChem CID 137286030) has the molecular formula C18H20CoN2O4
and a molecular weight of 387.30 g/mol. Its IUPAC name is cobalt;2-[2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]ethyliminomethyl]-6-methoxyphenol.
Molecular Properties
| Compound Name | cobalt;2-[2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]ethyliminomethyl]-6-methoxyphenol |
| PubChem CID | 137286030 |
| Molecular Formula | C18H20CoN2O4 |
| Molecular Weight | 387.30 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | cobalt;2-[2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]ethyliminomethyl]-6-methoxyphenol |
| SMILES | COc1cccc(/C=N/CC/N=C/c2cccc(OC)c2O)c1O.[Co] |
| InChI | InChI=1S/C18H20N2O4.Co/c1-23-15-7-3-5-13(17(15)21)11-19-9-10-20-12-14-6-4-8-16(24-2)18(14)22;/h3-8,11-12,21-22H,9-10H2,1-2H3;/b19-11+,20-12+; |
| InChIKey | IORICZNTFDDXCS-BYCVLTJGSA-N |
| XLogP | 2.65 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze cobalt;2-[2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]ethyliminomethyl]-6-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;2-[2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]ethyliminomethyl]-6-methoxyphenol?
The IUPAC name of cobalt;2-[2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]ethyliminomethyl]-6-methoxyphenol (CID 137286030) is cobalt;2-[2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]ethyliminomethyl]-6-methoxyphenol.
What is the SMILES notation for cobalt;2-[2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]ethyliminomethyl]-6-methoxyphenol?
The canonical SMILES for cobalt;2-[2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]ethyliminomethyl]-6-methoxyphenol is COc1cccc(/C=N/CC/N=C/c2cccc(OC)c2O)c1O.[Co].
What is the InChIKey of cobalt;2-[2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]ethyliminomethyl]-6-methoxyphenol?
The InChIKey is IORICZNTFDDXCS-BYCVLTJGSA-N. The full InChI is InChI=1S/C18H20N2O4.Co/c1-23-15-7-3-5-13(17(15)21)11-19-9-10-20-12-14-6-4-8-16(24-2)18(14)22;/h3-8,11-12,21-22H,9-10H2,1-2H3;/b19-11+,20-12+;.
What are the key properties of cobalt;2-[2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]ethyliminomethyl]-6-methoxyphenol?
cobalt;2-[2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]ethyliminomethyl]-6-methoxyphenol has a molecular weight of 387.30 g/mol, XLogP of 2.65, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;2-[2-[(2-hydroxy-3-methoxyphenyl)methylideneamino]ethyliminomethyl]-6-methoxyphenol is sourced from PubChem (CID 137286030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).