C18H12N2O5 — CID 137286258
8,10-dimethyl-1,5-dioxo-4H-pyrido[3,2-a]phenoxazine-3-carboxylic acid (PubChem CID 137286258) has the molecular formula C18H12N2O5 and a molecular weight of 336.30 g/mol. Its IUPAC name is 8,10-dimethyl-1,5-dioxo-4H-pyrido[3,2-a]phenoxazine-3-carboxylic acid.
| Compound Name | 8,10-dimethyl-1,5-dioxo-4H-pyrido[3,2-a]phenoxazine-3-carboxylic acid |
|---|---|
| PubChem CID | 137286258 |
| Molecular Formula | C18H12N2O5 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 8,10-dimethyl-1,5-dioxo-4H-pyrido[3,2-a]phenoxazine-3-carboxylic acid |
| SMILES | Cc1cc(C)c2oc3cc(=O)c4[nH]c(C(=O)O)cc(=O)c4c-3nc2c1 |
| InChI | InChI=1S/C18H12N2O5/c1-7-3-8(2)17-9(4-7)19-16-13(25-17)6-12(22)15-14(16)11(21)5-10(20-15)18(23)24/h3-6H,1-2H3,(H,20,21)(H,23,24) |
| InChIKey | HITVCFZFEFWATR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|