C16H25N5O15P2 — CID 137286751
[[(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S)-3,4,5-trihydroxy-6-methyloxan-2-yl] hydrogen phosphate (PubChem CID 137286751) has the molecular formula C16H25N5O15P2 and a molecular weight of 589.34 g/mol. Its IUPAC name is [[(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S)-3,4,5-trihydroxy-6-methyloxan-2-yl] hydrogen phosphate.
| Compound Name | [[(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S)-3,4,5-trihydroxy-6-methyloxan-2-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 137286751 |
| Molecular Formula | C16H25N5O15P2 |
| Molecular Weight | 589.34 g/mol |
| Exact Mass | 589.08 |
| IUPAC Name | [[(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S)-3,4,5-trihydroxy-6-methyloxan-2-yl] hydrogen phosphate |
| SMILES | CC1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](n3cnc4c(=O)[nH]c(N)nc43)C(O)[C@@H]2O)[C@@H](O)C(O)C1O |
| InChI | InChI=1S/C16H25N5O15P2/c1-4-7(22)9(24)11(26)15(33-4)35-38(30,31)36-37(28,29)32-2-5-8(23)10(25)14(34-5)21-3-18-6-12(21)19-16(17)20-13(6)27/h3-5,7-11,14-15,22-26H,2H2,1H3,(H,28,29)(H,30,31)(H3,17,19,20,27)/t4?,5-,7?,8-,9?,10?,11+,14-,15-/m1/s1 |
| InChIKey | LQEBEXMHBLQMDB-CUNYVXLKSA-N |
| XLogP | -3.60 |
| TPSA | 311.49 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.34 |
| LogP ≤ 5 | -3.60 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|