C10H15N5O2 — CID 137287178
2-amino-5-methyl-6-propanoyl-3,6,7,8-tetrahydropteridin-4-one (PubChem CID 137287178) has the molecular formula C10H15N5O2 and a molecular weight of 237.26 g/mol. Its IUPAC name is 2-amino-5-methyl-6-propanoyl-3,6,7,8-tetrahydropteridin-4-one.
| Compound Name | 2-amino-5-methyl-6-propanoyl-3,6,7,8-tetrahydropteridin-4-one |
|---|---|
| PubChem CID | 137287178 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 2-amino-5-methyl-6-propanoyl-3,6,7,8-tetrahydropteridin-4-one |
| SMILES | CCC(=O)C1CNc2nc(N)[nH]c(=O)c2N1C |
| InChI | InChI=1S/C10H15N5O2/c1-3-6(16)5-4-12-8-7(15(5)2)9(17)14-10(11)13-8/h5H,3-4H2,1-2H3,(H4,11,12,13,14,17) |
| InChIKey | SJYUNVVLAVYSJM-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |