C21H11F8N3O — CID 137287279
3,5-difluoro-4-[6-[4-fluoro-3-(1,1,2,2,2-pentafluoroethyl)phenyl]-2-methylimidazo[1,2-a]pyrazin-3-yl]phenol (PubChem CID 137287279) has the molecular formula C21H11F8N3O and a molecular weight of 473.32 g/mol. Its IUPAC name is 3,5-difluoro-4-[6-[4-fluoro-3-(1,1,2,2,2-pentafluoroethyl)phenyl]-2-methylimidazo[1,2-a]pyrazin-3-yl]phenol.
| Compound Name | 3,5-difluoro-4-[6-[4-fluoro-3-(1,1,2,2,2-pentafluoroethyl)phenyl]-2-methylimidazo[1,2-a]pyrazin-3-yl]phenol |
|---|---|
| PubChem CID | 137287279 |
| Molecular Formula | C21H11F8N3O |
| Molecular Weight | 473.32 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | 3,5-difluoro-4-[6-[4-fluoro-3-(1,1,2,2,2-pentafluoroethyl)phenyl]-2-methylimidazo[1,2-a]pyrazin-3-yl]phenol |
| SMILES | Cc1nc2cnc(-c3ccc(F)c(C(F)(F)C(F)(F)F)c3)cn2c1-c1c(F)cc(O)cc1F |
| InChI | InChI=1S/C21H11F8N3O/c1-9-19(18-14(23)5-11(33)6-15(18)24)32-8-16(30-7-17(32)31-9)10-2-3-13(22)12(4-10)20(25,26)21(27,28)29/h2-8,33H,1H3 |
| InChIKey | GFODWVNDLITPNF-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.32 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|