About CID 137287739
CID 137287739 (PubChem CID 137287739) has the molecular formula C62H62N4O2S
and a molecular weight of 927.27 g/mol.
Molecular Properties
| Compound Name | CID 137287739 |
| PubChem CID | 137287739 |
| Molecular Formula | C62H62N4O2S |
| Molecular Weight | 927.27 g/mol |
| Exact Mass | 926.46 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc(-c2c(-c3nc(-c4ccccc4)c(-c4ccccc4)[nH]3)sc(-c3nc(-c4ccccc4)c(-c4ccccc4)[nH]3)c2-c2cc(C(C)(C)C)c([O])c(C(C)(C)C)c2)cc(C(C)(C)C)c1[O] |
| InChI | InChI=1S/C62H62N4O2S/c1-59(2,3)43-33-41(34-44(53(43)67)60(4,5)6)47-48(42-35-45(61(7,8)9)54(68)46(36-42)62(10,11)12)56(58-65-51(39-29-21-15-22-30-39)52(66-58)40-31-23-16-24-32-40)69-55(47)57-63-49(37-25-17-13-18-26-37)50(64-57)38-27-19-14-20-28-38/h13-36H,1-12H3,(H,63,64)(H,65,66) |
| InChIKey | JTTLWUSNUKKQKF-UHFFFAOYSA-N |
| XLogP | 18.01 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 69 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 927.27 |
| LogP ≤ 5 | 18.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|
Analyze CID 137287739 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 137287739?
The IUPAC name of CID 137287739 (CID 137287739) is not available.
What is the SMILES notation for CID 137287739?
The canonical SMILES for CID 137287739 is CC(C)(C)c1cc(-c2c(-c3nc(-c4ccccc4)c(-c4ccccc4)[nH]3)sc(-c3nc(-c4ccccc4)c(-c4ccccc4)[nH]3)c2-c2cc(C(C)(C)C)c([O])c(C(C)(C)C)c2)cc(C(C)(C)C)c1[O].
What is the InChIKey of CID 137287739?
The InChIKey is JTTLWUSNUKKQKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C62H62N4O2S/c1-59(2,3)43-33-41(34-44(53(43)67)60(4,5)6)47-48(42-35-45(61(7,8)9)54(68)46(36-42)62(10,11)12)56(58-65-51(39-29-21-15-22-30-39)52(66-58)40-31-23-16-24-32-40)69-55(47)57-63-49(37-25-17-13-18-26-37)50(64-57)38-27-19-14-20-28-38/h13-36H,1-12H3,(H,63,64)(H,65,66).
What are the key properties of CID 137287739?
CID 137287739 has a molecular weight of 927.27 g/mol, XLogP of 18.01, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 137287739 is sourced from PubChem (CID 137287739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).