About 4-[(4-bromo-3,5-dimethylphenyl)diazenyl]phenol
4-[(4-bromo-3,5-dimethylphenyl)diazenyl]phenol (PubChem CID 137287745) has the molecular formula C14H13BrN2O
and a molecular weight of 305.18 g/mol. Its IUPAC name is 4-[(4-bromo-3,5-dimethylphenyl)diazenyl]phenol.
Molecular Properties
| Compound Name | 4-[(4-bromo-3,5-dimethylphenyl)diazenyl]phenol |
| PubChem CID | 137287745 |
| Molecular Formula | C14H13BrN2O |
| Molecular Weight | 305.18 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 4-[(4-bromo-3,5-dimethylphenyl)diazenyl]phenol |
| SMILES | Cc1cc(/N=N/c2ccc(O)cc2)cc(C)c1Br |
| InChI | InChI=1S/C14H13BrN2O/c1-9-7-12(8-10(2)14(9)15)17-16-11-3-5-13(18)6-4-11/h3-8,18H,1-2H3/b17-16+ |
| InChIKey | FLLAYWIHFHCDBO-WUKNDPDISA-N |
| XLogP | 5.19 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 305.18 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-bromo-3,5-dimethylphenyl)diazenyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-bromo-3,5-dimethylphenyl)diazenyl]phenol?
The IUPAC name of 4-[(4-bromo-3,5-dimethylphenyl)diazenyl]phenol (CID 137287745) is 4-[(4-bromo-3,5-dimethylphenyl)diazenyl]phenol.
What is the SMILES notation for 4-[(4-bromo-3,5-dimethylphenyl)diazenyl]phenol?
The canonical SMILES for 4-[(4-bromo-3,5-dimethylphenyl)diazenyl]phenol is Cc1cc(/N=N/c2ccc(O)cc2)cc(C)c1Br.
What is the InChIKey of 4-[(4-bromo-3,5-dimethylphenyl)diazenyl]phenol?
The InChIKey is FLLAYWIHFHCDBO-WUKNDPDISA-N. The full InChI is InChI=1S/C14H13BrN2O/c1-9-7-12(8-10(2)14(9)15)17-16-11-3-5-13(18)6-4-11/h3-8,18H,1-2H3/b17-16+.
What are the key properties of 4-[(4-bromo-3,5-dimethylphenyl)diazenyl]phenol?
4-[(4-bromo-3,5-dimethylphenyl)diazenyl]phenol has a molecular weight of 305.18 g/mol, XLogP of 5.19, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-bromo-3,5-dimethylphenyl)diazenyl]phenol is sourced from PubChem (CID 137287745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).