C48H34N4O2 — CID 137287747
4-[2,5-bis(4,5-diphenyl-1H-imidazol-2-yl)-4-(4-hydroxyphenyl)phenyl]phenol (PubChem CID 137287747) has the molecular formula C48H34N4O2 and a molecular weight of 698.83 g/mol. Its IUPAC name is 4-[2,5-bis(4,5-diphenyl-1H-imidazol-2-yl)-4-(4-hydroxyphenyl)phenyl]phenol.
| Compound Name | 4-[2,5-bis(4,5-diphenyl-1H-imidazol-2-yl)-4-(4-hydroxyphenyl)phenyl]phenol |
|---|---|
| PubChem CID | 137287747 |
| Molecular Formula | C48H34N4O2 |
| Molecular Weight | 698.83 g/mol |
| Exact Mass | 698.27 |
| IUPAC Name | 4-[2,5-bis(4,5-diphenyl-1H-imidazol-2-yl)-4-(4-hydroxyphenyl)phenyl]phenol |
| SMILES | Oc1ccc(-c2cc(-c3nc(-c4ccccc4)c(-c4ccccc4)[nH]3)c(-c3ccc(O)cc3)cc2-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)cc1 |
| InChI | InChI=1S/C48H34N4O2/c53-37-25-21-31(22-26-37)39-30-42(48-51-45(35-17-9-3-10-18-35)46(52-48)36-19-11-4-12-20-36)40(32-23-27-38(54)28-24-32)29-41(39)47-49-43(33-13-5-1-6-14-33)44(50-47)34-15-7-2-8-16-34/h1-30,53-54H,(H,49,50)(H,51,52) |
| InChIKey | HPPQYPXLGLTXQS-UHFFFAOYSA-N |
| XLogP | 11.88 |
| TPSA | 97.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.83 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|