C13H12FN5O4 — CID 137287879
2-[[4-[N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]oxy]acetamide (PubChem CID 137287879) has the molecular formula C13H12FN5O4 and a molecular weight of 321.27 g/mol. Its IUPAC name is 2-[[4-[N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]oxy]acetamide.
| Compound Name | 2-[[4-[N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]oxy]acetamide |
|---|---|
| PubChem CID | 137287879 |
| Molecular Formula | C13H12FN5O4 |
| Molecular Weight | 321.27 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 2-[[4-[N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]oxy]acetamide |
| SMILES | NC(=O)COc1nonc1/C(=N/[C@H]1Cc2ccc(F)cc21)NO |
| InChI | InChI=1S/C13H12FN5O4/c14-7-2-1-6-3-9(8(6)4-7)16-12(17-21)11-13(19-23-18-11)22-5-10(15)20/h1-2,4,9,21H,3,5H2,(H2,15,20)(H,16,17)/t9-/m0/s1 |
| InChIKey | VFYCUYXJKLWEKU-VIFPVBQESA-N |
| XLogP | 0.10 |
| TPSA | 135.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.27 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|