C15H17FN6O5S — CID 137287883
N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-4-[3-(sulfamoylamino)cyclobutyl]oxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 137287883) has the molecular formula C15H17FN6O5S and a molecular weight of 412.40 g/mol. Its IUPAC name is N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-4-[3-(sulfamoylamino)cyclobutyl]oxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-4-[3-(sulfamoylamino)cyclobutyl]oxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 137287883 |
| Molecular Formula | C15H17FN6O5S |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-4-[3-(sulfamoylamino)cyclobutyl]oxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | NS(=O)(=O)NC1CC(Oc2nonc2/C(=N/[C@H]2Cc3ccc(F)cc32)NO)C1 |
| InChI | InChI=1S/C15H17FN6O5S/c16-8-2-1-7-3-12(11(7)4-8)18-14(19-23)13-15(21-27-20-13)26-10-5-9(6-10)22-28(17,24)25/h1-2,4,9-10,12,22-23H,3,5-6H2,(H,18,19)(H2,17,24,25)/t9?,10?,12-/m0/s1 |
| InChIKey | AZUQBBRLBLWVAO-CBINBANVSA-N |
| XLogP | -0.07 |
| TPSA | 164.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|